C16H24N2O4 — CID 54291526
butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 54291526) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54291526 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)OC |
| InChI | InChI=1S/C16H24N2O4/c1-4-5-11-22-16(20)17-14(15(19)18(2)21-3)12-13-9-7-6-8-10-13/h6-10,14H,4-5,11-12H2,1-3H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | RXVGWVANIDZILC-AWEZNQCLSA-N |
| XLogP | 2.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|