C19H26N2O7 — CID 141381989
3-(butoxycarbonylamino)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid (PubChem CID 141381989) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is 3-(butoxycarbonylamino)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 3-(butoxycarbonylamino)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141381989 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-(butoxycarbonylamino)-4-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]-4-oxobutanoic acid |
| SMILES | CCCCOC(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H26N2O7/c1-3-4-10-28-19(26)21-14(12-16(22)23)17(24)20-15(18(25)27-2)11-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3,(H,20,24)(H,21,26)(H,22,23) |
| InChIKey | UGYVEKOQFQODES-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|