C25H32N2O6 — CID 54211161
benzyl (3R)-3-(butoxycarbonylamino)-4-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-4-oxobutanoate (PubChem CID 54211161) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is benzyl (3R)-3-(butoxycarbonylamino)-4-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-4-oxobutanoate.
| Compound Name | benzyl (3R)-3-(butoxycarbonylamino)-4-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54211161 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | benzyl (3R)-3-(butoxycarbonylamino)-4-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-4-oxobutanoate |
| SMILES | CCCCOC(=O)N[C@H](CC(=O)OCc1ccccc1)C(=O)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C25H32N2O6/c1-2-3-14-32-25(31)27-22(16-23(29)33-18-20-12-8-5-9-13-20)24(30)26-21(17-28)15-19-10-6-4-7-11-19/h4-13,21-22,28H,2-3,14-18H2,1H3,(H,26,30)(H,27,31)/t21-,22+/m0/s1 |
| InChIKey | PWARPNDJWTVTDP-FCHUYYIVSA-N |
| XLogP | 2.73 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|