C29H40N4O6 — CID 21120613
6-amino-2-[[2-[[2-(butoxycarbonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 21120613) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(butoxycarbonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(butoxycarbonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 21120613 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 6-amino-2-[[2-[[2-(butoxycarbonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CCCCOC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C29H40N4O6/c1-2-3-18-39-29(38)33-25(20-22-14-8-5-9-15-22)27(35)32-24(19-21-12-6-4-7-13-21)26(34)31-23(28(36)37)16-10-11-17-30/h4-9,12-15,23-25H,2-3,10-11,16-20,30H2,1H3,(H,31,34)(H,32,35)(H,33,38)(H,36,37) |
| InChIKey | AJUVDCPUBVHMBJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|