C32H44N6O10S — CID 22820611
(2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-(2-methylsulfonylethoxycarbonylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 22820611) has the molecular formula C32H44N6O10S and a molecular weight of 704.80 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-(2-methylsulfonylethoxycarbonylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-(2-methylsulfonylethoxycarbonylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22820611 |
| Molecular Formula | C32H44N6O10S |
| Molecular Weight | 704.80 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-(2-methylsulfonylethoxycarbonylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CS(=O)(=O)CCOC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C32H44N6O10S/c1-49(46,47)17-16-48-32(45)38-23(14-8-9-15-33)28(40)36-25(20-27(34)39)30(42)35-24(18-21-10-4-2-5-11-21)29(41)37-26(31(43)44)19-22-12-6-3-7-13-22/h2-7,10-13,23-26H,8-9,14-20,33H2,1H3,(H2,34,39)(H,35,42)(H,36,40)(H,37,41)(H,38,45)(H,43,44)/t23-,24-,25-,26-/m0/s1 |
| InChIKey | OJDBHMPUMUCECX-CQJMVLFOSA-N |
| XLogP | -0.85 |
| TPSA | 266.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.80 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|