C15H23NOSSi — CID 85240498
tert-butyl-(2-isothiocyanato-2-phenylethoxy)-dimethylsilane (PubChem CID 85240498) has the molecular formula C15H23NOSSi and a molecular weight of 293.51 g/mol. Its IUPAC name is tert-butyl-(2-isothiocyanato-2-phenylethoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2-isothiocyanato-2-phenylethoxy)-dimethylsilane |
|---|---|
| PubChem CID | 85240498 |
| Molecular Formula | C15H23NOSSi |
| Molecular Weight | 293.51 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | tert-butyl-(2-isothiocyanato-2-phenylethoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(N=C=S)c1ccccc1 |
| InChI | InChI=1S/C15H23NOSSi/c1-15(2,3)19(4,5)17-11-14(16-12-18)13-9-7-6-8-10-13/h6-10,14H,11H2,1-5H3 |
| InChIKey | XGSNVQBEEKNXCC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|