C22H29NOSSi — CID 175729927
tert-butyl-[(2S)-2-isothiocyanatopentoxy]-diphenylsilane (PubChem CID 175729927) has the molecular formula C22H29NOSSi and a molecular weight of 383.63 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-isothiocyanatopentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-isothiocyanatopentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 175729927 |
| Molecular Formula | C22H29NOSSi |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | tert-butyl-[(2S)-2-isothiocyanatopentoxy]-diphenylsilane |
| SMILES | CCC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=C=S |
| InChI | InChI=1S/C22H29NOSSi/c1-5-12-19(23-18-25)17-24-26(22(2,3)4,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16,19H,5,12,17H2,1-4H3/t19-/m0/s1 |
| InChIKey | JOXACXGKJABDLG-IBGZPJMESA-N |
| XLogP | 4.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|