C17H28Cl2OSi — CID 86287443
tert-butyl-[(2R,3R)-2,3-dichloro-5-phenylpentoxy]-dimethylsilane (PubChem CID 86287443) has the molecular formula C17H28Cl2OSi and a molecular weight of 347.40 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-2,3-dichloro-5-phenylpentoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-2,3-dichloro-5-phenylpentoxy]-dimethylsilane |
|---|---|
| PubChem CID | 86287443 |
| Molecular Formula | C17H28Cl2OSi |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | tert-butyl-[(2R,3R)-2,3-dichloro-5-phenylpentoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](Cl)[C@H](Cl)CCc1ccccc1 |
| InChI | InChI=1S/C17H28Cl2OSi/c1-17(2,3)21(4,5)20-13-16(19)15(18)12-11-14-9-7-6-8-10-14/h6-10,15-16H,11-13H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | JUWCVLUNZQDOPA-HZPDHXFCSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|