C31H46O3Si2 — CID 10052471
[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-yl] acetate (PubChem CID 10052471) has the molecular formula C31H46O3Si2 and a molecular weight of 522.88 g/mol. Its IUPAC name is [(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-yl] acetate.
| Compound Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-yl] acetate |
|---|---|
| PubChem CID | 10052471 |
| Molecular Formula | C31H46O3Si2 |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-yl] acetate |
| SMILES | CC(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)C(C)=C=C(C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H46O3Si2/c1-24(29(34-26(3)32)23-33-35(10,11)30(4,5)6)22-25(2)36(31(7,8)9,27-18-14-12-15-19-27)28-20-16-13-17-21-28/h12-21,29H,23H2,1-11H3/t22?,29-/m1/s1 |
| InChIKey | NFAWUCLVCNKTIN-OLVCOQPYSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|