C18H20F2OSi — CID 11472623
1-[tert-butyl(diphenyl)silyl]-2,2-difluoroethanone (PubChem CID 11472623) has the molecular formula C18H20F2OSi and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]-2,2-difluoroethanone.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 11472623 |
| Molecular Formula | C18H20F2OSi |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]-2,2-difluoroethanone |
| SMILES | CC(C)(C)[Si](C(=O)C(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20F2OSi/c1-18(2,3)22(17(21)16(19)20,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16H,1-3H3 |
| InChIKey | RPBJNUYTXBKQNC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|