C23H30OSi — CID 11121676
5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-ol (PubChem CID 11121676) has the molecular formula C23H30OSi and a molecular weight of 350.58 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-ol.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-ol |
|---|---|
| PubChem CID | 11121676 |
| Molecular Formula | C23H30OSi |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]-3-methylhexa-3,4-dien-2-ol |
| SMILES | CC(=C=C(C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)O |
| InChI | InChI=1S/C23H30OSi/c1-18(20(3)24)17-19(2)25(23(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,24H,1-6H3 |
| InChIKey | UVOXIDHHQBBART-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|