C27H40OSi2Sn — CID 6312841
(E)-3-[tert-butyl(diphenyl)silyl]-5-trimethylsilyl-2-trimethylstannylpent-2-en-4-yn-1-ol (PubChem CID 6312841) has the molecular formula C27H40OSi2Sn and a molecular weight of 555.50 g/mol. Its IUPAC name is (E)-3-[tert-butyl(diphenyl)silyl]-5-trimethylsilyl-2-trimethylstannylpent-2-en-4-yn-1-ol.
| Compound Name | (E)-3-[tert-butyl(diphenyl)silyl]-5-trimethylsilyl-2-trimethylstannylpent-2-en-4-yn-1-ol |
|---|---|
| PubChem CID | 6312841 |
| Molecular Formula | C27H40OSi2Sn |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | (E)-3-[tert-butyl(diphenyl)silyl]-5-trimethylsilyl-2-trimethylstannylpent-2-en-4-yn-1-ol |
| SMILES | CC(C)(C)[Si](/C(C#C[Si](C)(C)C)=C(\CO)[Sn](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31OSi2.3CH3.Sn/c1-24(2,3)27(21-13-9-7-10-14-21,22-15-11-8-12-16-22)23(17-19-25)18-20-26(4,5)6;;;;/h7-16,25H,19H2,1-6H3;3*1H3; |
| InChIKey | HNKRLTVZGFTQJD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|