C15H22OSi — CID 134967725
(1R)-2,2-dimethyl-1-phenyl-4-trimethylsilylbut-3-yn-1-ol (PubChem CID 134967725) has the molecular formula C15H22OSi and a molecular weight of 246.43 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-1-phenyl-4-trimethylsilylbut-3-yn-1-ol.
| Compound Name | (1R)-2,2-dimethyl-1-phenyl-4-trimethylsilylbut-3-yn-1-ol |
|---|---|
| PubChem CID | 134967725 |
| Molecular Formula | C15H22OSi |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (1R)-2,2-dimethyl-1-phenyl-4-trimethylsilylbut-3-yn-1-ol |
| SMILES | CC(C)(C#C[Si](C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H22OSi/c1-15(2,11-12-17(3,4)5)14(16)13-9-7-6-8-10-13/h6-10,14,16H,1-5H3/t14-/m1/s1 |
| InChIKey | PDIXTGYPSOKZKX-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|