C23H36OSi2 — CID 165389065
3-phenyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol (PubChem CID 165389065) has the molecular formula C23H36OSi2 and a molecular weight of 384.71 g/mol. Its IUPAC name is 3-phenyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol.
| Compound Name | 3-phenyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 165389065 |
| Molecular Formula | C23H36OSi2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3-phenyl-1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
| SMILES | CC(C)[Si](C#CC(O)(C#C[Si](C)(C)C)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36OSi2/c1-19(2)26(20(3)4,21(5)6)18-16-23(24,15-17-25(7,8)9)22-13-11-10-12-14-22/h10-14,19-21,24H,1-9H3 |
| InChIKey | IZCCUURERQKWHR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|