C27H44OSi2 — CID 46243481
tert-butyl-[2-ethynyl-2-phenyl-4-tri(propan-2-yl)silylbut-3-ynoxy]-dimethylsilane (PubChem CID 46243481) has the molecular formula C27H44OSi2 and a molecular weight of 440.82 g/mol. Its IUPAC name is tert-butyl-[2-ethynyl-2-phenyl-4-tri(propan-2-yl)silylbut-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-ethynyl-2-phenyl-4-tri(propan-2-yl)silylbut-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 46243481 |
| Molecular Formula | C27H44OSi2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | tert-butyl-[2-ethynyl-2-phenyl-4-tri(propan-2-yl)silylbut-3-ynoxy]-dimethylsilane |
| SMILES | C#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)(CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H44OSi2/c1-13-27(25-17-15-14-16-18-25,21-28-29(11,12)26(8,9)10)19-20-30(22(2)3,23(4)5)24(6)7/h1,14-18,22-24H,21H2,2-12H3 |
| InChIKey | VSBBOJDVKCUQKQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|