C14H18 — CID 134861944
[(3S)-3,5-dimethylhex-1-yn-3-yl]benzene (PubChem CID 134861944) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is [(3S)-3,5-dimethylhex-1-yn-3-yl]benzene.
| Compound Name | [(3S)-3,5-dimethylhex-1-yn-3-yl]benzene |
|---|---|
| PubChem CID | 134861944 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | [(3S)-3,5-dimethylhex-1-yn-3-yl]benzene |
| SMILES | C#C[C@](C)(CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H18/c1-5-14(4,11-12(2)3)13-9-7-6-8-10-13/h1,6-10,12H,11H2,2-4H3/t14-/m1/s1 |
| InChIKey | RJCJQERUFNHHQL-CQSZACIVSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|