C23H32 — CID 164800464
(2,4,4,6-tetramethyl-6-phenylheptan-2-yl)benzene (PubChem CID 164800464) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is (2,4,4,6-tetramethyl-6-phenylheptan-2-yl)benzene.
| Compound Name | (2,4,4,6-tetramethyl-6-phenylheptan-2-yl)benzene |
|---|---|
| PubChem CID | 164800464 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (2,4,4,6-tetramethyl-6-phenylheptan-2-yl)benzene |
| SMILES | CC(C)(CC(C)(C)c1ccccc1)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H32/c1-21(2,17-22(3,4)19-13-9-7-10-14-19)18-23(5,6)20-15-11-8-12-16-20/h7-16H,17-18H2,1-6H3 |
| InChIKey | MNUJCAGUGHPLQF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |