About Trineophyltin hydride
Trineophyltin hydride (PubChem CID 6327208) has the molecular formula C30H39Sn
and a molecular weight of 518.35 g/mol.
Molecular Properties
| Compound Name | Trineophyltin hydride |
| PubChem CID | 6327208 |
| Molecular Formula | C30H39Sn |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | — |
| SMILES | CC(C)(C[Sn](CC(C)(C)c1ccccc1)CC(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C10H13.Sn/c3*1-10(2,3)9-7-5-4-6-8-9;/h3*4-8H,1H2,2-3H3; |
| InChIKey | FIDXVVHZWRFINX-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Trineophyltin hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Trineophyltin hydride?
The IUPAC name of Trineophyltin hydride (CID 6327208) is not available.
What is the SMILES notation for Trineophyltin hydride?
The canonical SMILES for Trineophyltin hydride is CC(C)(C[Sn](CC(C)(C)c1ccccc1)CC(C)(C)c1ccccc1)c1ccccc1.
What is the InChIKey of Trineophyltin hydride?
The InChIKey is FIDXVVHZWRFINX-UHFFFAOYSA-N. The full InChI is InChI=1S/3C10H13.Sn/c3*1-10(2,3)9-7-5-4-6-8-9;/h3*4-8H,1H2,2-3H3;.
What are the key properties of Trineophyltin hydride?
Trineophyltin hydride has a molecular weight of 518.35 g/mol, XLogP of 8.41, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Trineophyltin hydride is sourced from PubChem (CID 6327208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).