About CID 67894217
CID 67894217 (PubChem CID 67894217) has the molecular formula C27H31F4Sn
and a molecular weight of 550.25 g/mol.
Molecular Properties
| Compound Name | CID 67894217 |
| PubChem CID | 67894217 |
| Molecular Formula | C27H31F4Sn |
| Molecular Weight | 550.25 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C[Sn](CC(C)(C)c1ccccc1)c1cccc(C(F)(F)F)c1)c1ccccc1.F |
| InChI | InChI=1S/2C10H13.C7H4F3.FH.Sn/c2*1-10(2,3)9-7-5-4-6-8-9;8-7(9,10)6-4-2-1-3-5-6;;/h2*4-8H,1H2,2-3H3;1-2,4-5H;1H; |
| InChIKey | XUUARMQCQGTBJK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.25 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 67894217 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67894217?
The IUPAC name of CID 67894217 (CID 67894217) is not available.
What is the SMILES notation for CID 67894217?
The canonical SMILES for CID 67894217 is CC(C)(C[Sn](CC(C)(C)c1ccccc1)c1cccc(C(F)(F)F)c1)c1ccccc1.F.
What is the InChIKey of CID 67894217?
The InChIKey is XUUARMQCQGTBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13.C7H4F3.FH.Sn/c2*1-10(2,3)9-7-5-4-6-8-9;8-7(9,10)6-4-2-1-3-5-6;;/h2*4-8H,1H2,2-3H3;1-2,4-5H;1H;.
What are the key properties of CID 67894217?
CID 67894217 has a molecular weight of 550.25 g/mol, XLogP of 7.52, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67894217 is sourced from PubChem (CID 67894217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).