About CID 14049284
CID 14049284 (PubChem CID 14049284) has the molecular formula C26H30FSn
and a molecular weight of 480.24 g/mol.
Molecular Properties
| Compound Name | CID 14049284 |
| PubChem CID | 14049284 |
| Molecular Formula | C26H30FSn |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C[Sn](CC(C)(C)c1ccccc1)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/2C10H13.C6H4F.Sn/c2*1-10(2,3)9-7-5-4-6-8-9;7-6-4-2-1-3-5-6;/h2*4-8H,1H2,2-3H3;2-5H; |
| InChIKey | IUGWWRUTJPOOSX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 14049284 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14049284?
The IUPAC name of CID 14049284 (CID 14049284) is not available.
What is the SMILES notation for CID 14049284?
The canonical SMILES for CID 14049284 is CC(C)(C[Sn](CC(C)(C)c1ccccc1)c1ccc(F)cc1)c1ccccc1.
What is the InChIKey of CID 14049284?
The InChIKey is IUGWWRUTJPOOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13.C6H4F.Sn/c2*1-10(2,3)9-7-5-4-6-8-9;7-6-4-2-1-3-5-6;/h2*4-8H,1H2,2-3H3;2-5H;.
What are the key properties of CID 14049284?
CID 14049284 has a molecular weight of 480.24 g/mol, XLogP of 6.48, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14049284 is sourced from PubChem (CID 14049284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).