C13H19Cl — CID 13095883
(4-chloro-2,4-dimethylpentan-2-yl)benzene (PubChem CID 13095883) has the molecular formula C13H19Cl and a molecular weight of 210.75 g/mol. Its IUPAC name is (4-chloro-2,4-dimethylpentan-2-yl)benzene.
| Compound Name | (4-chloro-2,4-dimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 13095883 |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (4-chloro-2,4-dimethylpentan-2-yl)benzene |
| SMILES | CC(C)(Cl)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H19Cl/c1-12(2,10-13(3,4)14)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | SUAAALDLPARNMH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|