C28H48Cl2 — CID 22975899
1,4-bis(6-chloro-2,4,4,6-tetramethylheptan-2-yl)benzene (PubChem CID 22975899) has the molecular formula C28H48Cl2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 1,4-bis(6-chloro-2,4,4,6-tetramethylheptan-2-yl)benzene.
| Compound Name | 1,4-bis(6-chloro-2,4,4,6-tetramethylheptan-2-yl)benzene |
|---|---|
| PubChem CID | 22975899 |
| Molecular Formula | C28H48Cl2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 1,4-bis(6-chloro-2,4,4,6-tetramethylheptan-2-yl)benzene |
| SMILES | CC(C)(Cl)CC(C)(C)CC(C)(C)c1ccc(C(C)(C)CC(C)(C)CC(C)(C)Cl)cc1 |
| InChI | InChI=1S/C28H48Cl2/c1-23(2,19-27(9,10)29)17-25(5,6)21-13-15-22(16-14-21)26(7,8)18-24(3,4)20-28(11,12)30/h13-16H,17-20H2,1-12H3 |
| InChIKey | OXLRVLXDSBGLPA-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|