C21H28O — CID 123620932
1-phenoxy-4-(2,4,4-trimethylhexan-2-yl)benzene (PubChem CID 123620932) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-phenoxy-4-(2,4,4-trimethylhexan-2-yl)benzene.
| Compound Name | 1-phenoxy-4-(2,4,4-trimethylhexan-2-yl)benzene |
|---|---|
| PubChem CID | 123620932 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-phenoxy-4-(2,4,4-trimethylhexan-2-yl)benzene |
| SMILES | CCC(C)(C)CC(C)(C)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28O/c1-6-20(2,3)16-21(4,5)17-12-14-19(15-13-17)22-18-10-8-7-9-11-18/h7-15H,6,16H2,1-5H3 |
| InChIKey | NQJRMPSJIPPNFG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |