C47H38O2 — CID 159934932
1-pentadeca-1,3,5,7,9,11,13-heptaynyl-3-phenoxybenzene;1-phenoxy-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 159934932) has the molecular formula C47H38O2 and a molecular weight of 634.82 g/mol. Its IUPAC name is 1-pentadeca-1,3,5,7,9,11,13-heptaynyl-3-phenoxybenzene;1-phenoxy-4-(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 1-pentadeca-1,3,5,7,9,11,13-heptaynyl-3-phenoxybenzene;1-phenoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 159934932 |
| Molecular Formula | C47H38O2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 1-pentadeca-1,3,5,7,9,11,13-heptaynyl-3-phenoxybenzene;1-phenoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CC#CC#CC#CC#CC#CC#CC#Cc1cccc(Oc2ccccc2)c1.CC(C)(C)CC(C)(C)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H12O.C20H26O/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-19-25-20-18-23-27(24-25)28-26-21-16-14-17-22-26;1-19(2,3)15-20(4,5)16-11-13-18(14-12-16)21-17-9-7-6-8-10-17/h14,16-18,20-24H,1H3;6-14H,15H2,1-5H3 |
| InChIKey | OACTWBJVNJPTBG-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|