C22H39V- — CID 163369923
1-ethyl-4-(2,4,4-trimethylhexan-2-yl)benzene;pentane;vanadium (PubChem CID 163369923) has the molecular formula C22H39V- and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-ethyl-4-(2,4,4-trimethylhexan-2-yl)benzene;pentane;vanadium.
| Compound Name | 1-ethyl-4-(2,4,4-trimethylhexan-2-yl)benzene;pentane;vanadium |
|---|---|
| PubChem CID | 163369923 |
| Molecular Formula | C22H39V- |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-ethyl-4-(2,4,4-trimethylhexan-2-yl)benzene;pentane;vanadium |
| SMILES | CCCCC.C[CH-]c1ccc(C(C)(C)CC(C)(C)CC)cc1.[V] |
| InChI | InChI=1S/C17H27.C5H12.V/c1-7-14-9-11-15(12-10-14)17(5,6)13-16(3,4)8-2;1-3-5-4-2;/h7,9-12H,8,13H2,1-6H3;3-5H2,1-2H3;/q-1;; |
| InChIKey | HTZCEEDTLSWDEO-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|