C25H38O2 — CID 161085826
4-(2-methylbutan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 161085826) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 4-(2-methylbutan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 161085826 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 4-(2-methylbutan-2-yl)phenol;4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)cc1.CCC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H22O.C11H16O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11;1-4-11(2,3)9-5-7-10(12)8-6-9/h6-9,15H,10H2,1-5H3;5-8,12H,4H2,1-3H3 |
| InChIKey | UGMMLWISYSNODG-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |