About 4-hexylphenol;4-(2-methylbutan-2-yl)phenol
4-hexylphenol;4-(2-methylbutan-2-yl)phenol (PubChem CID 70208179) has the molecular formula C23H34O2
and a molecular weight of 342.52 g/mol. Its IUPAC name is 4-hexylphenol;4-(2-methylbutan-2-yl)phenol.
Molecular Properties
| Compound Name | 4-hexylphenol;4-(2-methylbutan-2-yl)phenol |
| PubChem CID | 70208179 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 4-hexylphenol;4-(2-methylbutan-2-yl)phenol |
| SMILES | CCC(C)(C)c1ccc(O)cc1.CCCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C12H18O.C11H16O/c1-2-3-4-5-6-11-7-9-12(13)10-8-11;1-4-11(2,3)9-5-7-10(12)8-6-9/h7-10,13H,2-6H2,1H3;5-8,12H,4H2,1-3H3 |
| InChIKey | SKQUWXZZYYWXRB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexylphenol;4-(2-methylbutan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexylphenol;4-(2-methylbutan-2-yl)phenol?
The IUPAC name of 4-hexylphenol;4-(2-methylbutan-2-yl)phenol (CID 70208179) is 4-hexylphenol;4-(2-methylbutan-2-yl)phenol.
What is the SMILES notation for 4-hexylphenol;4-(2-methylbutan-2-yl)phenol?
The canonical SMILES for 4-hexylphenol;4-(2-methylbutan-2-yl)phenol is CCC(C)(C)c1ccc(O)cc1.CCCCCCc1ccc(O)cc1.
What is the InChIKey of 4-hexylphenol;4-(2-methylbutan-2-yl)phenol?
The InChIKey is SKQUWXZZYYWXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O.C11H16O/c1-2-3-4-5-6-11-7-9-12(13)10-8-11;1-4-11(2,3)9-5-7-10(12)8-6-9/h7-10,13H,2-6H2,1H3;5-8,12H,4H2,1-3H3.
What are the key properties of 4-hexylphenol;4-(2-methylbutan-2-yl)phenol?
4-hexylphenol;4-(2-methylbutan-2-yl)phenol has a molecular weight of 342.52 g/mol, XLogP of 6.59, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexylphenol;4-(2-methylbutan-2-yl)phenol is sourced from PubChem (CID 70208179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).