C26H40O2 — CID 160837498
2,4-bis(2-methylbutan-2-yl)phenol;4-butylphenol (PubChem CID 160837498) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 2,4-bis(2-methylbutan-2-yl)phenol;4-butylphenol.
| Compound Name | 2,4-bis(2-methylbutan-2-yl)phenol;4-butylphenol |
|---|---|
| PubChem CID | 160837498 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2,4-bis(2-methylbutan-2-yl)phenol;4-butylphenol |
| SMILES | CCC(C)(C)c1ccc(O)c(C(C)(C)CC)c1.CCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C16H26O.C10H14O/c1-7-15(3,4)12-9-10-14(17)13(11-12)16(5,6)8-2;1-2-3-4-9-5-7-10(11)8-6-9/h9-11,17H,7-8H2,1-6H3;5-8,11H,2-4H2,1H3 |
| InChIKey | SHPCLBLFTDSANE-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |