C20H26O2 — CID 19894473
2-[2-(4-butylphenyl)butan-2-yl]benzene-1,4-diol (PubChem CID 19894473) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[2-(4-butylphenyl)butan-2-yl]benzene-1,4-diol.
| Compound Name | 2-[2-(4-butylphenyl)butan-2-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 19894473 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[2-(4-butylphenyl)butan-2-yl]benzene-1,4-diol |
| SMILES | CCCCc1ccc(C(C)(CC)c2cc(O)ccc2O)cc1 |
| InChI | InChI=1S/C20H26O2/c1-4-6-7-15-8-10-16(11-9-15)20(3,5-2)18-14-17(21)12-13-19(18)22/h8-14,21-22H,4-7H2,1-3H3 |
| InChIKey | DDMUNNCVDJDWCL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|