About 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol
4-nonylphenol;4-(2-phenylpropan-2-yl)phenol (PubChem CID 19993999) has the molecular formula C30H40O2
and a molecular weight of 432.65 g/mol. Its IUPAC name is 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol.
Molecular Properties
| Compound Name | 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol |
| PubChem CID | 19993999 |
| Molecular Formula | C30H40O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol |
| SMILES | CC(C)(c1ccccc1)c1ccc(O)cc1.CCCCCCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O.C15H24O/c1-15(2,12-6-4-3-5-7-12)13-8-10-14(16)11-9-13;1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h3-11,16H,1-2H3;10-13,16H,2-9H2,1H3 |
| InChIKey | DVRJKFLYUGVIAC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol?
The IUPAC name of 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol (CID 19993999) is 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol.
What is the SMILES notation for 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol?
The canonical SMILES for 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol is CC(C)(c1ccccc1)c1ccc(O)cc1.CCCCCCCCCc1ccc(O)cc1.
What is the InChIKey of 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol?
The InChIKey is DVRJKFLYUGVIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O.C15H24O/c1-15(2,12-6-4-3-5-7-12)13-8-10-14(16)11-9-13;1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h3-11,16H,1-2H3;10-13,16H,2-9H2,1H3.
What are the key properties of 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol?
4-nonylphenol;4-(2-phenylpropan-2-yl)phenol has a molecular weight of 432.65 g/mol, XLogP of 8.40, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nonylphenol;4-(2-phenylpropan-2-yl)phenol is sourced from PubChem (CID 19993999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).