C14H21NO2 — CID 58779359
4-[(5E)-5-hydroxyimino-2,4,4-trimethylpentan-2-yl]phenol (PubChem CID 58779359) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-[(5E)-5-hydroxyimino-2,4,4-trimethylpentan-2-yl]phenol.
| Compound Name | 4-[(5E)-5-hydroxyimino-2,4,4-trimethylpentan-2-yl]phenol |
|---|---|
| PubChem CID | 58779359 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-[(5E)-5-hydroxyimino-2,4,4-trimethylpentan-2-yl]phenol |
| SMILES | CC(C)(/C=N/O)CC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H21NO2/c1-13(2,10-15-17)9-14(3,4)11-5-7-12(16)8-6-11/h5-8,10,16-17H,9H2,1-4H3/b15-10+ |
| InChIKey | PDAQTXWQIYDWKQ-XNTDXEJSSA-N |
| XLogP | 3.55 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|