C36H40O4 — CID 135254228
4-[(Z)-4,6,8-tris(4-hydroxyphenyl)-4,6,8-trimethylnon-2-en-2-yl]phenol (PubChem CID 135254228) has the molecular formula C36H40O4 and a molecular weight of 536.71 g/mol. Its IUPAC name is 4-[(Z)-4,6,8-tris(4-hydroxyphenyl)-4,6,8-trimethylnon-2-en-2-yl]phenol.
| Compound Name | 4-[(Z)-4,6,8-tris(4-hydroxyphenyl)-4,6,8-trimethylnon-2-en-2-yl]phenol |
|---|---|
| PubChem CID | 135254228 |
| Molecular Formula | C36H40O4 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 4-[(Z)-4,6,8-tris(4-hydroxyphenyl)-4,6,8-trimethylnon-2-en-2-yl]phenol |
| SMILES | C/C(=C/C(C)(CC(C)(CC(C)(C)c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C36H40O4/c1-25(26-6-14-30(37)15-7-26)22-35(4,28-10-18-32(39)19-11-28)24-36(5,29-12-20-33(40)21-13-29)23-34(2,3)27-8-16-31(38)17-9-27/h6-22,37-40H,23-24H2,1-5H3/b25-22- |
| InChIKey | UIGSARDOHXERCU-LVWGJNHUSA-N |
| XLogP | 8.59 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |