C17H28O — CID 141467055
4-(2,7,7-trimethyloctan-2-yl)phenol (PubChem CID 141467055) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-(2,7,7-trimethyloctan-2-yl)phenol.
| Compound Name | 4-(2,7,7-trimethyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 141467055 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 4-(2,7,7-trimethyloctan-2-yl)phenol |
| SMILES | CC(C)(C)CCCCC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H28O/c1-16(2,3)12-6-7-13-17(4,5)14-8-10-15(18)11-9-14/h8-11,18H,6-7,12-13H2,1-5H3 |
| InChIKey | KBPMGVVGQMRSSF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|