C16H25IO — CID 162524309
[4-(3,5,5-trimethylheptan-3-yl)phenyl] hypoiodite (PubChem CID 162524309) has the molecular formula C16H25IO and a molecular weight of 360.28 g/mol. Its IUPAC name is [4-(3,5,5-trimethylheptan-3-yl)phenyl] hypoiodite.
| Compound Name | [4-(3,5,5-trimethylheptan-3-yl)phenyl] hypoiodite |
|---|---|
| PubChem CID | 162524309 |
| Molecular Formula | C16H25IO |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [4-(3,5,5-trimethylheptan-3-yl)phenyl] hypoiodite |
| SMILES | CCC(C)(C)CC(C)(CC)c1ccc(OI)cc1 |
| InChI | InChI=1S/C16H25IO/c1-6-15(3,4)12-16(5,7-2)13-8-10-14(18-17)11-9-13/h8-11H,6-7,12H2,1-5H3 |
| InChIKey | HNDNDXOJUPNHEL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|