C31H48O3 — CID 23135771
1,1-bis(2-butoxy-5-tert-butylphenyl)propan-1-ol (PubChem CID 23135771) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is 1,1-bis(2-butoxy-5-tert-butylphenyl)propan-1-ol.
| Compound Name | 1,1-bis(2-butoxy-5-tert-butylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 23135771 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 1,1-bis(2-butoxy-5-tert-butylphenyl)propan-1-ol |
| SMILES | CCCCOc1ccc(C(C)(C)C)cc1C(O)(CC)c1cc(C(C)(C)C)ccc1OCCCC |
| InChI | InChI=1S/C31H48O3/c1-10-13-19-33-27-17-15-23(29(4,5)6)21-25(27)31(32,12-3)26-22-24(30(7,8)9)16-18-28(26)34-20-14-11-2/h15-18,21-22,32H,10-14,19-20H2,1-9H3 |
| InChIKey | QEFSJDXEEFAIQJ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|