(2-butoxy-3,5-ditert-butylphenyl)boronic acid

C18H31BO3 — CID 22345412

IUPAC(2-butoxy-3,5-ditert-butylphenyl)boronic acid
SMILESCCCCOc1c(B(O)O)cc(C(C)(C)C)cc1C(C)(C)C
InChIInChI=1S/C18H31BO3/c1-8-9-10-22-16-14(18(5,6)7)11-13(17(2,3)4)12-15(16)19(20)21/h11-12,20-21H,8-10H2,1-7H3
InChIKeyCDQGCFBAHDIMHJ-UHFFFAOYSA-N
MW306.26 g/mol
LogP3.14
Rot. Bonds5

About (2-butoxy-3,5-ditert-butylphenyl)boronic acid

(2-butoxy-3,5-ditert-butylphenyl)boronic acid (PubChem CID 22345412) has the molecular formula C18H31BO3 and a molecular weight of 306.26 g/mol. Its IUPAC name is (2-butoxy-3,5-ditert-butylphenyl)boronic acid.

Molecular Properties

Compound Name(2-butoxy-3,5-ditert-butylphenyl)boronic acid
PubChem CID22345412
Molecular FormulaC18H31BO3
Molecular Weight306.26 g/mol
Exact Mass306.24
IUPAC Name(2-butoxy-3,5-ditert-butylphenyl)boronic acid
SMILESCCCCOc1c(B(O)O)cc(C(C)(C)C)cc1C(C)(C)C
InChIInChI=1S/C18H31BO3/c1-8-9-10-22-16-14(18(5,6)7)11-13(17(2,3)4)12-15(16)19(20)21/h11-12,20-21H,8-10H2,1-7H3
InChIKeyCDQGCFBAHDIMHJ-UHFFFAOYSA-N
XLogP3.14
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.26
LogP ≤ 53.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-butoxy-3,5-ditert-butylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-butoxy-3,5-ditert-butylphenyl)boronic acid?
The IUPAC name of (2-butoxy-3,5-ditert-butylphenyl)boronic acid (CID 22345412) is (2-butoxy-3,5-ditert-butylphenyl)boronic acid.
What is the SMILES notation for (2-butoxy-3,5-ditert-butylphenyl)boronic acid?
The canonical SMILES for (2-butoxy-3,5-ditert-butylphenyl)boronic acid is CCCCOc1c(B(O)O)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of (2-butoxy-3,5-ditert-butylphenyl)boronic acid?
The InChIKey is CDQGCFBAHDIMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31BO3/c1-8-9-10-22-16-14(18(5,6)7)11-13(17(2,3)4)12-15(16)19(20)21/h11-12,20-21H,8-10H2,1-7H3.
What are the key properties of (2-butoxy-3,5-ditert-butylphenyl)boronic acid?
(2-butoxy-3,5-ditert-butylphenyl)boronic acid has a molecular weight of 306.26 g/mol, XLogP of 3.14, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butoxy-3,5-ditert-butylphenyl)boronic acid is sourced from PubChem (CID 22345412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).