C18H31BO3 — CID 22345412
(2-butoxy-3,5-ditert-butylphenyl)boronic acid (PubChem CID 22345412) has the molecular formula C18H31BO3 and a molecular weight of 306.26 g/mol. Its IUPAC name is (2-butoxy-3,5-ditert-butylphenyl)boronic acid.
| Compound Name | (2-butoxy-3,5-ditert-butylphenyl)boronic acid |
|---|---|
| PubChem CID | 22345412 |
| Molecular Formula | C18H31BO3 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | (2-butoxy-3,5-ditert-butylphenyl)boronic acid |
| SMILES | CCCCOc1c(B(O)O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C18H31BO3/c1-8-9-10-22-16-14(18(5,6)7)11-13(17(2,3)4)12-15(16)19(20)21/h11-12,20-21H,8-10H2,1-7H3 |
| InChIKey | CDQGCFBAHDIMHJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|