C39H65NO3 — CID 67327177
2-amino-1,1-bis(4-butoxy-3,5-ditert-butylphenyl)propan-1-ol (PubChem CID 67327177) has the molecular formula C39H65NO3 and a molecular weight of 595.95 g/mol. Its IUPAC name is 2-amino-1,1-bis(4-butoxy-3,5-ditert-butylphenyl)propan-1-ol.
| Compound Name | 2-amino-1,1-bis(4-butoxy-3,5-ditert-butylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 67327177 |
| Molecular Formula | C39H65NO3 |
| Molecular Weight | 595.95 g/mol |
| Exact Mass | 595.50 |
| IUPAC Name | 2-amino-1,1-bis(4-butoxy-3,5-ditert-butylphenyl)propan-1-ol |
| SMILES | CCCCOc1c(C(C)(C)C)cc(C(O)(c2cc(C(C)(C)C)c(OCCCC)c(C(C)(C)C)c2)C(C)N)cc1C(C)(C)C |
| InChI | InChI=1S/C39H65NO3/c1-16-18-20-42-33-29(35(4,5)6)22-27(23-30(33)36(7,8)9)39(41,26(3)40)28-24-31(37(10,11)12)34(43-21-19-17-2)32(25-28)38(13,14)15/h22-26,41H,16-21,40H2,1-15H3 |
| InChIKey | AKFNIXIDMRJNOB-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.95 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|