C28H42O3 — CID 10432631
(2E,4E,6E)-7-(3,5-ditert-butyl-2-pentoxyphenyl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 10432631) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (2E,4E,6E)-7-(3,5-ditert-butyl-2-pentoxyphenyl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-7-(3,5-ditert-butyl-2-pentoxyphenyl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 10432631 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (2E,4E,6E)-7-(3,5-ditert-butyl-2-pentoxyphenyl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CCCCCOc1c(/C(C)=C/C=C/C(C)=C/C(=O)O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C28H42O3/c1-10-11-12-16-31-26-23(21(3)15-13-14-20(2)17-25(29)30)18-22(27(4,5)6)19-24(26)28(7,8)9/h13-15,17-19H,10-12,16H2,1-9H3,(H,29,30)/b14-13+,20-17+,21-15+ |
| InChIKey | XERPMZZZQCXGKA-JDYIGCTCSA-N |
| XLogP | 7.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|