C26H34O3 — CID 173311581
7-(6,8-ditert-butyl-2H-chromen-3-yl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 173311581) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 7-(6,8-ditert-butyl-2H-chromen-3-yl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | 7-(6,8-ditert-butyl-2H-chromen-3-yl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 173311581 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 7-(6,8-ditert-butyl-2H-chromen-3-yl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(C=CC=C(C)C1=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2OC1)=CC(=O)O |
| InChI | InChI=1S/C26H34O3/c1-17(12-23(27)28)10-9-11-18(2)20-13-19-14-21(25(3,4)5)15-22(26(6,7)8)24(19)29-16-20/h9-15H,16H2,1-8H3,(H,27,28) |
| InChIKey | YNUDSTDDPIGLBU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|