C18H26N2O2 — CID 170562577
6,8-ditert-butyl-N'-hydroxy-2H-chromene-3-carboximidamide (PubChem CID 170562577) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 6,8-ditert-butyl-N'-hydroxy-2H-chromene-3-carboximidamide.
| Compound Name | 6,8-ditert-butyl-N'-hydroxy-2H-chromene-3-carboximidamide |
|---|---|
| PubChem CID | 170562577 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 6,8-ditert-butyl-N'-hydroxy-2H-chromene-3-carboximidamide |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OCC(/C(N)=N/O)=C2 |
| InChI | InChI=1S/C18H26N2O2/c1-17(2,3)13-8-11-7-12(16(19)20-21)10-22-15(11)14(9-13)18(4,5)6/h7-9,21H,10H2,1-6H3,(H2,19,20) |
| InChIKey | FURRQFKFYNBANW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|