C15H24N2O2 — CID 135699520
3,5-ditert-butyl-N',4-dihydroxybenzenecarboximidamide (PubChem CID 135699520) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3,5-ditert-butyl-N',4-dihydroxybenzenecarboximidamide.
| Compound Name | 3,5-ditert-butyl-N',4-dihydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 135699520 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3,5-ditert-butyl-N',4-dihydroxybenzenecarboximidamide |
| SMILES | CC(C)(C)c1cc(/C(N)=N/O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C15H24N2O2/c1-14(2,3)10-7-9(13(16)17-19)8-11(12(10)18)15(4,5)6/h7-8,18-19H,1-6H3,(H2,16,17) |
| InChIKey | JRYOPRGSHOUFDG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|