C16H26ClNO2 — CID 175666737
2,6-ditert-butyl-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol;hydrochloride (PubChem CID 175666737) has the molecular formula C16H26ClNO2 and a molecular weight of 299.84 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol;hydrochloride.
| Compound Name | 2,6-ditert-butyl-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 175666737 |
| Molecular Formula | C16H26ClNO2 |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2,6-ditert-butyl-4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol;hydrochloride |
| SMILES | C/C(=N\O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C16H25NO2.ClH/c1-10(17-19)11-8-12(15(2,3)4)14(18)13(9-11)16(5,6)7;/h8-9,18-19H,1-7H3;1H/b17-10+; |
| InChIKey | WQIHRYWITLWVOZ-LZMXEPDESA-N |
| XLogP | 4.61 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|