C17H26N2O — CID 123519720
N'-(3,5-ditert-butyl-4-hydroxyphenyl)-N-methylideneethanimidamide (PubChem CID 123519720) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is N'-(3,5-ditert-butyl-4-hydroxyphenyl)-N-methylideneethanimidamide.
| Compound Name | N'-(3,5-ditert-butyl-4-hydroxyphenyl)-N-methylideneethanimidamide |
|---|---|
| PubChem CID | 123519720 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N'-(3,5-ditert-butyl-4-hydroxyphenyl)-N-methylideneethanimidamide |
| SMILES | C=N/C(C)=N/c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O/c1-11(18-8)19-12-9-13(16(2,3)4)15(20)14(10-12)17(5,6)7/h9-10,20H,8H2,1-7H3/b19-11+ |
| InChIKey | VEVFBXLWSCIUGH-YBFXNURJSA-N |
| XLogP | 4.74 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|