C15H23N3O2 — CID 4637687
(3,5-ditert-butyl-4-hydroxyphenyl)iminourea (PubChem CID 4637687) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)iminourea.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)iminourea |
|---|---|
| PubChem CID | 4637687 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)iminourea |
| SMILES | CC(C)(C)c1cc(/N=N/C(N)=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C15H23N3O2/c1-14(2,3)10-7-9(17-18-13(16)20)8-11(12(10)19)15(4,5)6/h7-8,19H,1-6H3,(H2,16,20)/b18-17+ |
| InChIKey | GNZGGEZOYUNMLY-ISLYRVAYSA-N |
| XLogP | 4.15 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|