C19H32N2O5 — CID 87766135
2-amino-2-(hydroxymethyl)propane-1,3-diol;2,6-ditert-butyl-4-isocyanatophenol (PubChem CID 87766135) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,6-ditert-butyl-4-isocyanatophenol.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,6-ditert-butyl-4-isocyanatophenol |
|---|---|
| PubChem CID | 87766135 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2,6-ditert-butyl-4-isocyanatophenol |
| SMILES | CC(C)(C)c1cc(N=C=O)cc(C(C)(C)C)c1O.NC(CO)(CO)CO |
| InChI | InChI=1S/C15H21NO2.C4H11NO3/c1-14(2,3)11-7-10(16-9-17)8-12(13(11)18)15(4,5)6;5-4(1-6,2-7)3-8/h7-8,18H,1-6H3;6-8H,1-3,5H2 |
| InChIKey | JBXJDAWLDNNCCX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|