C10H15N3O — CID 122198369
5-tert-butyl-N'-hydroxypyridine-3-carboximidamide (PubChem CID 122198369) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-tert-butyl-N'-hydroxypyridine-3-carboximidamide.
| Compound Name | 5-tert-butyl-N'-hydroxypyridine-3-carboximidamide |
|---|---|
| PubChem CID | 122198369 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 5-tert-butyl-N'-hydroxypyridine-3-carboximidamide |
| SMILES | CC(C)(C)c1cncc(C(N)=NO)c1 |
| InChI | InChI=1S/C10H15N3O/c1-10(2,3)8-4-7(5-12-6-8)9(11)13-14/h4-6,14H,1-3H3,(H2,11,13) |
| InChIKey | KSRJJYQSPJDUHR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|