C38H51AlN2O2 — CID 20767332
14,16,22,24-tetratert-butyl-19-ethyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaene (PubChem CID 20767332) has the molecular formula C38H51AlN2O2 and a molecular weight of 594.82 g/mol. Its IUPAC name is 14,16,22,24-tetratert-butyl-19-ethyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaene.
| Compound Name | 14,16,22,24-tetratert-butyl-19-ethyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaene |
|---|---|
| PubChem CID | 20767332 |
| Molecular Formula | C38H51AlN2O2 |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | 14,16,22,24-tetratert-butyl-19-ethyl-18,20-dioxa-3,10-diaza-19-aluminatetracyclo[19.4.0.04,9.012,17]pentacosa-1(21),2,4,6,8,10,12(17),13,15,22,24-undecaene |
| SMILES | CC[Al]1Oc2c(cc(C(C)(C)C)cc2C(C)(C)C)/C=N/c2ccccc2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C36H48N2O2.C2H5.Al/c1-33(2,3)25-17-23(31(39)27(19-25)35(7,8)9)21-37-29-15-13-14-16-30(29)38-22-24-18-26(34(4,5)6)20-28(32(24)40)36(10,11)12;1-2;/h13-22,39-40H,1-12H3;1H2,2H3;/q;;+2/p-2/b37-21+,38-22+;; |
| InChIKey | SQMSENDGQXBYAE-XIDIDSRISA-L |
| XLogP | 10.66 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |