C76H104 — CID 173053195
1,2,3,4-tetrakis(2,4-ditert-butyl-6-ethylphenyl)biphenylene (PubChem CID 173053195) has the molecular formula C76H104 and a molecular weight of 1017.67 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(2,4-ditert-butyl-6-ethylphenyl)biphenylene.
| Compound Name | 1,2,3,4-tetrakis(2,4-ditert-butyl-6-ethylphenyl)biphenylene |
|---|---|
| PubChem CID | 173053195 |
| Molecular Formula | C76H104 |
| Molecular Weight | 1017.67 g/mol |
| Exact Mass | 1016.81 |
| IUPAC Name | 1,2,3,4-tetrakis(2,4-ditert-butyl-6-ethylphenyl)biphenylene |
| SMILES | CCc1cc(C(C)(C)C)cc(C(C)(C)C)c1-c1c2c(c(-c3c(CC)cc(C(C)(C)C)cc3C(C)(C)C)c(-c3c(CC)cc(C(C)(C)C)cc3C(C)(C)C)c1-c1c(CC)cc(C(C)(C)C)cc1C(C)(C)C)-c1ccccc1-2 |
| InChI | InChI=1S/C76H104/c1-29-45-37-49(69(5,6)7)41-55(73(17,18)19)59(45)65-63-53-35-33-34-36-54(53)64(63)66(60-46(30-2)38-50(70(8,9)10)42-56(60)74(20,21)22)68(62-48(32-4)40-52(72(14,15)16)44-58(62)76(26,27)28)67(65)61-47(31-3)39-51(71(11,12)13)43-57(61)75(23,24)25/h33-44H,29-32H2,1-28H3 |
| InChIKey | VHQZZOSHZQIKKS-UHFFFAOYSA-N |
| XLogP | 22.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.67 |
| LogP ≤ 5 | 22.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |