C40H42 — CID 141153745
1-(2,4,6-tritert-butylphenyl)pentacene (PubChem CID 141153745) has the molecular formula C40H42 and a molecular weight of 522.78 g/mol. Its IUPAC name is 1-(2,4,6-tritert-butylphenyl)pentacene.
| Compound Name | 1-(2,4,6-tritert-butylphenyl)pentacene |
|---|---|
| PubChem CID | 141153745 |
| Molecular Formula | C40H42 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 1-(2,4,6-tritert-butylphenyl)pentacene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2cccc3cc4cc5cc6ccccc6cc5cc4cc23)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H42/c1-38(2,3)32-23-35(39(4,5)6)37(36(24-32)40(7,8)9)33-16-12-15-27-19-30-20-28-17-25-13-10-11-14-26(25)18-29(28)21-31(30)22-34(27)33/h10-24H,1-9H3 |
| InChIKey | VKMFKSWNZBLHHH-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|