C84H123O2P — CID 87306706
bis[2,3-bis(2,4,6-tritert-butylphenyl)phenoxy]phosphane (PubChem CID 87306706) has the molecular formula C84H123O2P and a molecular weight of 1195.88 g/mol. Its IUPAC name is bis[2,3-bis(2,4,6-tritert-butylphenyl)phenoxy]phosphane.
| Compound Name | bis[2,3-bis(2,4,6-tritert-butylphenyl)phenoxy]phosphane |
|---|---|
| PubChem CID | 87306706 |
| Molecular Formula | C84H123O2P |
| Molecular Weight | 1195.88 g/mol |
| Exact Mass | 1194.93 |
| IUPAC Name | bis[2,3-bis(2,4,6-tritert-butylphenyl)phenoxy]phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2cccc(OPOc3cccc(-c4c(C(C)(C)C)cc(C(C)(C)C)cc4C(C)(C)C)c3-c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c2-c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C84H123O2P/c1-73(2,3)51-43-57(77(13,14)15)67(58(44-51)78(16,17)18)55-39-37-41-65(69(55)71-61(81(25,26)27)47-53(75(7,8)9)48-62(71)82(28,29)30)85-87-86-66-42-38-40-56(68-59(79(19,20)21)45-52(74(4,5)6)46-60(68)80(22,23)24)70(66)72-63(83(31,32)33)49-54(76(10,11)12)50-64(72)84(34,35)36/h37-50,87H,1-36H3 |
| InChIKey | SZBCLFZJBOPLHB-UHFFFAOYSA-N |
| XLogP | 25.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.88 |
| LogP ≤ 5 | 25.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|